CAS 6207-55-2
:3,6-di-O-methyl-D-glucose
Description:
3,6-Di-O-methyl-D-glucose is a methylated derivative of D-glucose, characterized by the presence of two methoxy groups (-OCH3) at the 3 and 6 positions of the glucose molecule. This modification alters its physical and chemical properties compared to the parent glucose. The compound is typically a white to off-white crystalline solid, soluble in organic solvents like methanol and ethanol, but less soluble in water due to the hydrophobic nature of the methoxy groups. It retains the basic structure of glucose, including the six-membered pyranose ring, which is crucial for its biological activity. The introduction of methoxy groups can influence its reactivity, making it less susceptible to certain enzymatic processes that act on glucose. 3,6-Di-O-methyl-D-glucose is often used in biochemical research and synthetic organic chemistry as a building block or as a tool to study carbohydrate interactions and modifications. Its CAS number, 6207-55-2, is a unique identifier that facilitates its identification in chemical databases and literature.
Formula:C8H16O6
InChI:InChI=1/C8H16O6/c1-13-4-6(11)7(12)8(14-2)5(10)3-9/h3,5-8,10-12H,4H2,1-2H3/t5-,6+,7+,8+/m0/s1
Synonyms:- D-glucose, 3,6-di-O-methyl-
- 3,6-Di-O-methyl-D-glucose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3,6-Di-O-methyl-D-glucose
CAS:3,6-Di-O-methyl-D-glucose is a glycopeptide sugar that is used as a terminal sugar in the cell wall of many gram-positive bacteria. It is found on the surface of most strains of Streptococcus pneumoniae and Staphylococcus aureus. 3,6-Di-O-methyl-D-glucose is an antigen for monoclonal antibodies against the streptococcal M protein and has been used to identify the carbohydrate chemistry of Streptococcus pneumoniae. 3,6-Di-O-methyl glucose may also be useful in the detection of cellulose derivatives by magnetic resonance spectroscopy or nitrocellulose membranes. The terminal sugars found on these membranes are hydrolyzed by acid and dry weight methods before being analyzed by gas chromatography or high performance liquid chromatography.Formula:C8H16O6Purity:Min. 95%Molecular weight:208.21 g/mol
