CAS 62075-28-9
:(2S,3R)-3-amino-3-phenylpropane-1,2-diol
Description:
(2S,3R)-3-amino-3-phenylpropane-1,2-diol, with the CAS number 62075-28-9, is an organic compound characterized by its chiral centers at the second and third carbon atoms. This compound features an amino group (-NH2) and two hydroxyl groups (-OH) attached to a propane backbone, contributing to its potential as a versatile building block in organic synthesis. The presence of the phenyl group enhances its hydrophobic characteristics, while the hydroxyl groups increase its polarity, allowing for hydrogen bonding and solubility in polar solvents. The specific stereochemistry indicated by the (2S,3R) configuration suggests that this compound may exhibit unique biological activities or interactions, making it of interest in pharmaceutical research. Its structural features may also influence its reactivity and stability under various conditions. Overall, (2S,3R)-3-amino-3-phenylpropane-1,2-diol is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its functional groups and stereochemical properties.
Formula:C9H13NO2
InChI:InChI=1/C9H13NO2/c10-9(8(12)6-11)7-4-2-1-3-5-7/h1-5,8-9,11-12H,6,10H2/t8-,9-/m1/s1
SMILES:c1ccc(cc1)[C@H]([C@@H](CO)O)N
Synonyms:- 62075-28-9
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
