CAS 62078-98-2
:2-Bromo-N-(2-chloroethyl)-N-ethylbenzenemethanamine
Description:
2-Bromo-N-(2-chloroethyl)-N-ethylbenzenemethanamine, with the CAS number 62078-98-2, is a chemical compound that features a complex structure characterized by the presence of a bromine atom, a chloroethyl group, and an ethyl group attached to a benzenemethanamine backbone. This compound is typically classified as an organic amine, which indicates that it contains an amine functional group (-NH2 or -NHR) that can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of halogen atoms (bromine and chlorine) suggests that it may exhibit reactivity typical of halogenated compounds, such as potential for electrophilic aromatic substitution or nucleophilic displacement. Additionally, the compound's structure implies potential applications in medicinal chemistry or as an intermediate in the synthesis of more complex organic molecules. Its physical properties, such as solubility, boiling point, and melting point, would depend on the specific interactions of its functional groups and overall molecular structure. Safety and handling precautions should be observed due to the presence of halogens and the amine group.
Formula:C11H15BrClN
InChI:InChI=1S/C11H15BrClN/c1-2-14(8-7-13)9-10-5-3-4-6-11(10)12/h3-6H,2,7-9H2,1H3
InChI key:InChIKey=SDJLVPMBBFRBLL-UHFFFAOYSA-N
SMILES:C(N(CCCl)CC)C1=C(Br)C=CC=C1
Synonyms:- 2-Bromo-N-(2-chloroethyl)-N-ethylbenzenemethanamine
- Benzenemethanamine, 2-bromo-N-(2-chloroethyl)-N-ethyl-
- Benzenemethanamine, 2-bromo-N-(2-chloroethyl)-N-ethyl-, hydrochloride (1:1)
- Dsp 4
- N-(2-Bromobenzyl)-2-chloro-N-ethylethanamine hydrochloride (1:1)
- N-(2-Chloroethyl)-N-ethyl-2-bromobenzylamine
- [(2-Bromophenyl)methyl](2-chloroethyl)ethylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
DSP 4
CAS:DSP 4: neurotoxin targeting locus coeruleus, crosses blood-brain barrier, forms aziridinium, enters nerves via noradrenaline transporter.Formula:C11H15BrClNColor and Shape:SolidMolecular weight:276.6
