CAS 62089-34-3

3-methoxy-5-methylbenzoic acid

Description:

3-Methoxy-5-methylbenzoic acid, with the CAS number 62089-34-3, is an aromatic carboxylic acid characterized by a methoxy group and a methyl group attached to a benzoic acid framework. This compound features a methoxy (-OCH₃) substituent at the meta position and a methyl (-CH₃) substituent at the para position relative to the carboxylic acid group (-COOH) on the benzene ring. It is typically a white to off-white solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of both the methoxy and methyl groups can influence its chemical reactivity, making it a potential candidate for various organic synthesis applications. Additionally, the compound may exhibit weak acidic properties due to the carboxylic acid functional group, allowing it to participate in acid-base reactions. Its structural features may also contribute to its potential biological activity, making it of interest in medicinal chemistry and materials science.

Formula: C₉H₁₀O₃

InChI: InChI=1S/C9H10O3/c1-6-3-7(9(10)11)5-8(4-6)12-2/h3-5H,1-2H3,(H,10,11)

InChI key: InChIKey=ALUKWQVSCATDLJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(OC)=CC(C)=C1

Synonyms:

• 3-Methyl-5-methoxybenzoic acid
• Benzoic acid, 3-methoxy-5-methyl-
• NSC 175905
• m-Anisic acid, 5-methyl-
• 3-Methoxy-5-methylbenzoic acid
• (3-Methoxy-5-methylphenyl)methanol

3-Methoxy-5-methylbenzoic acid

CAS: 62089-34-3

Formula: C₉H₁₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.1739

Ref: IN-DA003JN2

3-Methoxy-5-methyl benzoic acid

CAS: 62089-34-3

3-Methoxy-5-methyl benzoic acid

Purity: 98%

Molecular weight: 166.17g/mol

Ref: 54-OR345381

3-Methoxy-5-methylbenzoic acid

CAS: 62089-34-3

Formula: C₉H₁₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.176

Ref: 10-F038674