CymitQuimica logo

CAS 6209-47-8

:

4-acetyl-1-(5-bromopyridin-2-yl)-3-hydroxy-5-(4-nitrophenyl)-1,5-dihydro-2H-pyrrol-2-one

Description:
4-acetyl-1-(5-bromopyridin-2-yl)-3-hydroxy-5-(4-nitrophenyl)-1,5-dihydro-2H-pyrrol-2-one, with the CAS number 6209-47-8, is a complex organic compound characterized by its unique structural features. It contains a pyrrolone ring, which is a five-membered lactam, and incorporates various functional groups such as an acetyl group, a hydroxyl group, and a nitrophenyl moiety. The presence of the bromopyridine substituent adds to its molecular complexity and may influence its reactivity and biological activity. This compound is likely to exhibit interesting chemical properties, including potential solubility in organic solvents and varying stability under different pH conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of multiple functional groups that can participate in various chemical reactions. Additionally, the nitro group may impart specific electronic properties, making it a candidate for further studies in drug design or as a synthetic intermediate in organic synthesis.
Formula:C17H12BrN3O5
InChI:InChI=1/C17H12BrN3O5/c1-9(22)14-15(10-2-5-12(6-3-10)21(25)26)20(17(24)16(14)23)13-7-4-11(18)8-19-13/h2-8,15,23H,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.