CAS 620986-48-3

4-acetyl-N-propylbenzenesulfonamide

Description:

4-Acetyl-N-propylbenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The structure features a benzene ring substituted with an acetyl group and a propyl group, contributing to its unique chemical behavior. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic propyl chain and polar sulfonamide group. It may participate in various chemical reactions, including nucleophilic substitutions and acylation, owing to the presence of the acetyl group. The sulfonamide moiety can engage in hydrogen bonding, influencing its interactions with biological targets. This compound may be of interest in pharmaceutical research, particularly in the development of new drugs or as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular environment and conditions under which it is studied. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₁H₁₅NO₃S

InChI: InChI=1/C11H15NO3S/c1-3-8-12-16(14,15)11-6-4-10(5-7-11)9(2)13/h4-7,12H,3,8H2,1-2H3

SMILES: CCCNS(=O)(=O)c1ccc(cc1)C(=O)C

4-Acetyl-N-propylbenzene-1-sulfonamide

CAS: 620986-48-3

Versatile small molecule scaffold

Formula: C₁₁H₁₅NO₃S

Purity: Min. 95%

Molecular weight: 241.31 g/mol

Ref: 3D-VZA98648