CAS 621-31-8
:3-(Ethylamino)phenol
Description:
3-(Ethylamino)phenol, with the CAS number 621-31-8, is an organic compound characterized by the presence of an ethylamino group attached to a phenolic ring. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its role as an intermediate in the synthesis of various dyes and pharmaceuticals. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, the hydroxyl group on the phenol ring contributes to its reactivity, enabling it to form hydrogen bonds and participate in oxidation reactions. 3-(Ethylamino)phenol is soluble in organic solvents and exhibits moderate solubility in water, influenced by the pH of the solution. Safety precautions should be taken when handling this compound, as it may pose health risks, including skin and respiratory irritation. Overall, its chemical properties make it valuable in synthetic organic chemistry and industrial applications.
Formula:C8H11NO
InChI:InChI=1S/C8H11NO/c1-2-9-7-4-3-5-8(10)6-7/h3-6,9-10H,2H2,1H3
InChI key:InChIKey=TVKZDKSHNITMRZ-UHFFFAOYSA-N
SMILES:N(CC)C1=CC(O)=CC=C1
Synonyms:- 3-(Ethylamino)phenol
- Brn 2637735
- Ccris 4640
- N-Ethyl-3-aminophenol
- N-Ethyl-m-aminophenol
- Phenol, 3-(ethylamino)-
- Phenol, 3-(ethylamino)- (9CI)
- Phenol, m-(ethylamino)-
- m-(Ethylamino)phenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(Ethylamino)phenol
CAS:Controlled ProductApplications 3-(ethylamino)phenol (cas# 621-31-8) is a useful research chemical.
Formula:C8H11NOColor and Shape:NeatMolecular weight:137.183-(Ethylamino)phenol
CAS:3-(Ethylamino)phenol is a phenolic compound that has low detection limits. It can be detected in the presence of other aminophenols, polyester polymers, and acrylates. 3-(Ethylamino)phenol has been used as a fluorophore for acrylate-based polymers and as an antifungal agent with sulfide to inhibit the growth of fungi. This compound also shows red shift under uv absorption or fluorescence spectroscopy, which is due to the electron withdrawing effect of the ethylamino group.Formula:C8H11NOPurity:Min. 95%Molecular weight:137.18 g/mol




