CAS 621-79-4
:Cinnamamide
Description:
Cinnamamide, with the CAS number 621-79-4, is an organic compound characterized by its amide functional group attached to a cinnamyl moiety. It typically appears as a white to off-white crystalline solid and has a distinctive aromatic odor due to the presence of the cinnamyl group, which is derived from cinnamon. Cinnamamide is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, owing to its biological activity. It exhibits properties such as antimicrobial and anti-inflammatory effects, making it of interest in medicinal chemistry. The compound is soluble in organic solvents but has limited solubility in water, which is a common trait for many amides. Its stability under standard conditions allows for its use in various chemical reactions and formulations. Additionally, cinnamamide can undergo hydrolysis, leading to the formation of cinnamic acid and ammonia under certain conditions. Overall, cinnamamide's unique structure and properties make it a valuable compound in both research and industrial applications.
Formula:C9H9NO
InChI:InChI=1S/C9H9NO/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H2,10,11)
InChI key:InChIKey=APEJMQOBVMLION-UHFFFAOYSA-N
SMILES:C(=CC(N)=O)C1=CC=CC=C1
Synonyms:- (Z)-3-phenylprop-2-enamide
- 2-Benzylideneacetamide
- 2-Propenamide, 3-phenyl-
- 3-Phenyl-2-propenamide
- 3-Phenylacrylamide
- 3-Phenylpropenamide
- Ag 835
- Cinnamamide,predominantly trans
- Cinnamic acid amide
- Coumaramide
- NSC 32953
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Cinnamamide, predominantly trans, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H9NOPurity:97%Color and Shape:Crystalline powder, White to creamMolecular weight:147.18Cinnamamide
CAS:Cinnamamide, the amide of trans-cinnamic acid, metabolized by Streptomyces, lessens tumor weight in C26 mouse colon cancer.Formula:C9H9NOColor and Shape:White CrystalMolecular weight:147.17Cinnamamide
CAS:Cinnamamide is a natural compound that is structurally related to the amino acid lysine and has been shown to regulate skin cell proliferation. Cinnamamide has also been found to be an effective inhibitor of the mitochondrial membrane potential in human erythrocytes. It has been shown to inhibit the production of reactive oxygen species (ROS) and reverse oxidative damage in cells, which may reduce the risk of developing autoimmune diseases. Cinnamamide is also able to prevent cell death caused by epidermal growth factor (EGF) withdrawal and induce apoptosis in HL-60 cells.Formula:C9H9NOPurity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:147.17 g/molCinnamamide
CAS:Formula:C9H9NOPurity:95.0%Color and Shape:Solid, Off-white powderMolecular weight:147.177






