CAS 62100-28-1

(1-methylidene-3-oxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid

Description:

(1-methylidene-3-oxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid, with the CAS number 62100-28-1, is a chemical compound that features a complex structure characterized by an isoindole framework. This compound typically exhibits properties associated with both acidic and carbonyl functionalities, which can influence its reactivity and interactions with other molecules. The presence of the acetic acid moiety suggests that it can participate in acid-base reactions, while the isoindole structure may contribute to its potential as a bioactive compound. The compound may also display specific solubility characteristics depending on the solvent used, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, due to its unique structure, it may have applications in medicinal chemistry or as an intermediate in organic synthesis. However, detailed studies would be necessary to fully elucidate its physical and chemical properties, as well as its potential biological activities.

Formula: C₁₁H₉NO₃

InChI: InChI=1/C11H9NO3/c1-7-8-4-2-3-5-9(8)11(15)12(7)6-10(13)14/h2-5H,1,6H2,(H,13,14)

SMILES: C=C1c2ccccc2C(=O)N1CC(=O)O

Synonyms:

• (1-methylene-3-oxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid

2-(1-Methylidene-3-oxo-2,3-dihydro-1H-isoindol-2-yl)acetic acid

CAS: 62100-28-1

Versatile small molecule scaffold

Formula: C₁₁H₉NO₃

Purity: Min. 95%

Molecular weight: 203.19 g/mol

Ref: 3D-MCA10028