CAS 62108-22-9
:2,5,9-trimethyldecane
Description:
2,5,9-Trimethyldecane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C15H32, indicating it consists of 15 carbon atoms and 32 hydrogen atoms. This compound features three methyl groups attached to a decane backbone, specifically at the 2nd, 5th, and 9th carbon positions. As a saturated hydrocarbon, it is characterized by single carbon-carbon bonds, which contribute to its stability and relatively low reactivity compared to unsaturated hydrocarbons. 2,5,9-Trimethyldecane is typically a colorless liquid at room temperature and is insoluble in water but soluble in organic solvents. Its physical properties, such as boiling point and melting point, are influenced by its molecular structure and branching, which generally lead to lower boiling points compared to straight-chain alkanes of similar molecular weight. This compound is of interest in various applications, including as a component in fuels and lubricants, and in the study of hydrocarbon behavior in different chemical environments.
Formula:C13H28
InChI:InChI=1/C13H28/c1-11(2)7-6-8-13(5)10-9-12(3)4/h11-13H,6-10H2,1-5H3
Synonyms:- 2,5,9-Trimethyldecane
- decane, 2,5,9-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
