CAS 62108-23-0
:2,5,6-trimethyldecane
Description:
2,5,6-trimethyldecane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C13H28, indicating it consists of 13 carbon atoms and 28 hydrogen atoms. This compound features three methyl groups attached to a decane backbone, which contributes to its branched structure. As a result, 2,5,6-trimethyldecane exhibits characteristics typical of alkanes, such as being non-polar and hydrophobic, making it insoluble in water but soluble in organic solvents. It has a relatively high boiling point compared to straight-chain alkanes of similar molecular weight due to increased branching, which reduces surface area and van der Waals forces. This compound is likely to be a colorless liquid at room temperature and may have a mild hydrocarbon odor. Its applications may include use as a solvent or in the formulation of fuels and lubricants. Safety data should be consulted for handling and storage, as with all hydrocarbons, due to potential flammability and health hazards.
Formula:C13H28
InChI:InChI=1/C13H28/c1-6-7-8-12(4)13(5)10-9-11(2)3/h11-13H,6-10H2,1-5H3
SMILES:CCCCC(C)C(C)CCC(C)C
Synonyms:- Decane, 2,5,6-Trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,5,6-Trimethyldecane
CAS:Controlled ProductFormula:C13H28Color and Shape:NeatMolecular weight:184.361Ref: 4Z-D-167004
Discontinued product

