CAS 62119-70-4
:1-Benzofuran-2-ylacetic acid
Description:
1-Benzofuran-2-ylacetic acid, with the CAS number 62119-70-4, is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. This compound features an acetic acid functional group attached to the benzofuran moiety, contributing to its chemical reactivity and potential biological activity. It typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic nature. The presence of the carboxylic acid group allows for hydrogen bonding, which can influence its interactions in biological systems. 1-Benzofuran-2-ylacetic acid may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its derivatives and analogs are often explored for potential therapeutic applications, including anti-inflammatory and analgesic effects. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C10H8O3
InChI:InChI=1/C10H8O3/c11-10(12)6-8-5-7-3-1-2-4-9(7)13-8/h1-5H,6H2,(H,11,12)
SMILES:c1ccc2c(c1)cc(CC(=O)O)o2
Synonyms:- 2-Benzofuranacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ref: IN-DA00EG4E
1g123.00€5g344.00€10g555.00€25gTo inquire100gTo inquire50mg56.00€100mg63.00€250mg76.00€2-Benzofuranacetic acid
CAS:Formula:C10H8O3Purity:97%Color and Shape:Brown powderMolecular weight:176.1712-(Benzofuran-2-yl)acetic acid
CAS:2-(Benzofuran-2-yl)acetic acid is a glp-1 analogue that has been shown to inhibit fatty acid synthesis in the test tube. It has also shown an inhibitory effect on cardiac arrhythmia and chloride ion channel activity, which may be due to the dipole nature of its structure. 2-(Benzofuran-2-yl)acetic acid is not active against microbial infections. The chemical compound is a tautomer of 2-[(benzofuran-2-yl)amino]acetic acid.Purity:Min. 95%



