CAS 6212-32-4: 5-(4-chlorophenyl)imidazolidine-2,4-dione

Description: 5-(4-Chlorophenyl)imidazolidine-2,4-dione, also known as a derivative of imidazolidine, is a chemical compound characterized by its imidazolidine ring structure, which features two carbonyl groups at the 2 and 4 positions. The presence of a 4-chlorophenyl group at the 5-position contributes to its unique properties, including potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. The chlorophenyl substituent may influence its reactivity and interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its full biological profile. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₉H₇ClN₂O₂

InChI: InChI=1/C9H7ClN2O2/c10-6-3-1-5(2-4-6)7-8(13)12-9(14)11-7/h1-4,7H,(H2,11,12,13,14)

5-(4-chlorophenyl)imidazolidine-2,4-dione

CAS: 6212-32-4

• Purity: 95.0%
• Molecular weight: 210.6199951171875

5-(4-Chlorophenyl)imidazolidine-2,4-dione

CAS: 6212-32-4

Versatile small molecule scaffold

• Formula: C₉H₇ClN₂O₂
• Purity: Min. 95%
• Molecular weight: 210.62 g/mol