CAS 62122-70-7
:4-acetylpiperazine-1-carboximidamide
Description:
4-Acetylpiperazine-1-carboximidamide is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features an acetyl group and a carboximidamide functional group, contributing to its unique reactivity and potential applications in medicinal chemistry. It is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being soluble in polar solvents due to the presence of the carboximidamide group. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its structure allows for various interactions with biological targets, which can be explored in drug design. As with many chemical substances, safety and handling precautions should be observed, as the specific toxicity and safety profile would depend on its concentration and exposure. Overall, 4-acetylpiperazine-1-carboximidamide represents a versatile scaffold in organic synthesis and drug discovery.
Formula:C7H14N4O
InChI:InChI=1/C7H14N4O/c1-6(12)10-2-4-11(5-3-10)7(8)9/h2-5H2,1H3,(H3,8,9)
SMILES:CC(=O)N1CCN(CC1)C(=N)N
Synonyms:- 1-Piperazinecarboximidamide, 4-Acetyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
