CymitQuimica logo

CAS 62124-30-5

:

1-(2-hydroxyethyl)piperidine-4-carboxamide

Description:
1-(2-Hydroxyethyl)piperidine-4-carboxamide, with the CAS number 62124-30-5, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a hydroxyl group and a carboxamide functional group, contributing to its solubility in polar solvents and potential for hydrogen bonding. The presence of the hydroxyethyl group enhances its hydrophilicity, making it more soluble in water compared to other piperidine derivatives. It is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological conditions due to its ability to interact with various biological systems. The compound's stability, reactivity, and biological activity can be influenced by the functional groups attached to the piperidine ring, making it a subject of interest in medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H16N2O2
InChI:InChI=1/C8H16N2O2/c9-8(12)7-1-3-10(4-2-7)5-6-11/h7,11H,1-6H2,(H2,9,12)
SMILES:C1CN(CCC1C(=N)O)CCO
Synonyms:
  • 1-(2-Hydroxy-ethyl)-piperidine-4-carboxylic acid amide
  • 4-Piperidinecarboxamide, 1-(2-hydroxyethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.