CAS 62124-43-0
:2-Chloro-5-phenylthiazole
Description:
2-Chloro-5-phenylthiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a chlorine atom at the second position and a phenyl group at the fifth position of the thiazole ring contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. It may exhibit antimicrobial, antifungal, or herbicidal properties, making it of interest in various fields of research. The molecular structure allows for specific interactions with biological targets, which can be explored for drug development. Additionally, 2-Chloro-5-phenylthiazole may undergo various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Safety and handling precautions should be observed, as with many chemical substances, to mitigate any potential hazards associated with its use.
Formula:C9H6ClNO
InChI:InChI=1/C9H6ClNO/c10-9-11-6-8(12-9)7-4-2-1-3-5-7/h1-6H
SMILES:c1ccc(cc1)c1cnc(Cl)o1
Synonyms:- 2-Chloro-5-phenyl-1,3-oxazole
- Oxazole, 2-Chloro-5-Phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Oxazole, 2-chloro-5-phenyl-
CAS:Formula:C9H6ClNOPurity:98%Color and Shape:SolidMolecular weight:179.60302-Chloro-5-phenyloxazole
CAS:2-Chloro-5-phenyloxazole is an organic compound that belongs to the class of c2-6 alkenyl, acyloxyalkyl, and formyl compounds. It is also a carboxylic acid derivative. 2-Chloro-5-phenyloxazole has been shown to be active against bacteria such as Staphylococcus aureus and Pseudomonas aeruginosa. This drug has been shown to have antibacterial properties against a variety of organisms, including gram positive and gram negative bacteria.
Formula:C9H6ClNOPurity:Min. 95%Molecular weight:179.6 g/mol



