CAS 6214-65-9: 5-Acetyl-2,4(1H,3H)-pyrimidinedione
Description:5-Acetyl-2,4(1H,3H)-pyrimidinedione, also known as 5-acetyluracil, is an organic compound belonging to the pyrimidine family. It features a pyrimidine ring substituted with an acetyl group at the 5-position and keto groups at the 2 and 4 positions. This compound is characterized by its ability to participate in various chemical reactions due to the presence of both carbonyl and nitrogen functionalities, making it a versatile intermediate in organic synthesis. It is typically a solid at room temperature and is soluble in polar solvents such as water and alcohols. The compound exhibits tautomeric behavior, which can influence its reactivity and interactions with other molecules. Additionally, 5-acetyl-2,4(1H,3H)-pyrimidinedione has potential applications in pharmaceuticals and biochemistry, particularly in the study of nucleic acids and as a building block for more complex organic compounds. Its CAS number, 6214-65-9, is used for identification in chemical databases and regulatory contexts.
Formula:C6H6N2O3
InChI:InChI=1S/C6H6N2O3/c1-3(9)4-2-7-6(11)8-5(4)10/h2H,1H3,(H2,7,8,10,11)
InChI key:InChIKey=YNYDWEIQSDFDLK-UHFFFAOYSA-N
SMILES:O=C1NC=C(C(=O)N1)C(=O)C
- Synonyms:
- 1-(2,4-Dihydroxy-pyrimidin-5-yl)-ethanone
- 2,4(1H,3H)-pyrimidinedione, 5-acetyl-
- 5-Acetouracil
- 5-Acetyl-2,4(1H,3H)-pyrimidinedione
- 5-Acetylpyrimidine-2,4(1H,3H)-dione
- NSC 34716
- Uracil, 5-acetyl-
- 5-Acetyl-1H-pyrimidine-2,4-dione
- 5-Acetyluracil
