CAS 62147-27-7
:H-Hyp-OBzl . HCl
Description:
H-Hyp-OBzl·HCl, also known as hydrochloride salt of a specific derivative of histidine, is a chemical compound characterized by its structure that includes a histidine moiety modified with a benzyl ether group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and polar organic solvents due to the presence of the hydrochloride salt, which enhances its solubility. The presence of the benzyl group contributes to its hydrophobic characteristics, while the hydrochloride form provides stability and facilitates its use in various biochemical applications. H-Hyp-OBzl·HCl is often utilized in peptide synthesis and as a building block in medicinal chemistry, particularly in the development of pharmaceuticals. Its properties, such as melting point and specific reactivity, can vary based on the purity and specific formulation. As with many chemical substances, proper handling and storage conditions are essential to maintain its integrity and effectiveness in research or industrial applications.
Formula:C12H16ClNO3
InChI:InChI=1/C12H15NO3.ClH/c14-10-6-11(13-7-10)12(15)16-8-9-4-2-1-3-5-9;/h1-5,10-11,13-14H,6-8H2;1H/t10-,11+;/m1./s1
Synonyms:- L-4-Hydroxy-proline benzyl ester hydrochloride
- benzyl (4R)-4-hydroxy-L-prolinate hydrochloride
- H-Hyp-OBzl・HCl
- Trans-L-4-Hydroxy-Proline Benzyl Ester HCl
- H-Hyp-Obzl Hcl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-4-Hydroxy-proline benzyl ester, HCl
CAS:Formula:C12H16ClNO3Purity:97%Color and Shape:SolidMolecular weight:257.7133Ref: IN-DA0032CG
1kgTo inquire5kgTo inquire500gTo inquire1g26.00€5g28.00€10g47.00€25g73.00€100g159.00€L-4-Hydroxy-Proline Benzyl Ester Hydrochloride
CAS:L-4-Hydroxy-Proline Benzyl Ester HydrochloridePurity:98%Molecular weight:257.71g/mol(2S,4R)-Benzyl 4-hydroxypyrrolidine-2-carboxylatehydrochloride
CAS:Formula:C12H16ClNO3Purity:97%Color and Shape:SolidMolecular weight:257.71



