CAS 62152-17-4
:ethyl[10-(3-morpholin-4-ylpropanoyl)-5-oxido-10H-phenothiazin-2-yl]carbamic acid
Description:
Ethyl[10-(3-morpholin-4-ylpropanoyl)-5-oxido-10H-phenothiazin-2-yl]carbamic acid, identified by its CAS number 62152-17-4, is a chemical compound that belongs to the class of phenothiazine derivatives. This substance features a phenothiazine core, which is characterized by a sulfur and nitrogen-containing heterocyclic structure, contributing to its potential biological activity. The presence of the morpholine moiety suggests that it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. The carbamic acid functional group indicates that it may participate in hydrogen bonding and could influence its solubility and reactivity. Additionally, the oxido group implies the presence of an oxygen atom that may enhance its oxidative stability or reactivity. Overall, this compound's unique structural features may confer specific pharmacological properties, making it of interest in therapeutic applications, although detailed studies would be necessary to elucidate its biological effects and mechanisms of action.
Formula:C22H25N3O5S
InChI:InChI=1/C22H25N3O5S/c1-2-24(22(27)28)16-7-8-20-18(15-16)25(17-5-3-4-6-19(17)31(20)29)21(26)9-10-23-11-13-30-14-12-23/h3-8,15H,2,9-14H2,1H3,(H,27,28)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
