CAS 6216-38-2
:4,6-bis(methylamino)cyclohexane-1,2,3,5-tetrol
Description:
4,6-bis(methylamino)cyclohexane-1,2,3,5-tetrol, with the CAS number 6216-38-2, is a chemical compound characterized by its cyclohexane structure that features multiple hydroxyl (–OH) groups and methylamino (–NH(CH3)2) substituents. This compound is a polyol, indicating that it contains multiple alcohol functional groups, which contribute to its potential solubility in water and ability to form hydrogen bonds. The presence of methylamino groups suggests that it may exhibit basic properties and could participate in various chemical reactions, including those involving amine functionalities. Its structural complexity allows for potential applications in pharmaceuticals, where such compounds may serve as intermediates or active ingredients due to their biological activity. Additionally, the compound's stereochemistry and the arrangement of its functional groups can significantly influence its reactivity and interactions with biological systems. Overall, 4,6-bis(methylamino)cyclohexane-1,2,3,5-tetrol is a notable compound in organic chemistry with implications in medicinal chemistry and materials science.
Formula:C8H18N2O4
InChI:InChI=1/C8H18N2O4/c1-9-3-5(11)4(10-2)7(13)8(14)6(3)12/h3-14H,1-2H3
SMILES:CNC1C(C(C(C(C1O)O)O)NC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
