CymitQuimica logo

CAS 62176-38-9

:

5-Bromo-2-[(3,4-dichlorophenyl)methoxy]benzoic acid

Description:
5-Bromo-2-[(3,4-dichlorophenyl)methoxy]benzoic acid, with the CAS number 62176-38-9, is an organic compound characterized by its complex aromatic structure. It features a benzoic acid moiety substituted with a bromine atom and a methoxy group linked to a dichlorophenyl group. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of halogen atoms (bromine and chlorine) often influences its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may possess biological activity, which could be of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, making it a subject of study in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Bromo-2-[(3,4-dichlorophenyl)methoxy]benzoic acid is notable for its unique structural features and potential applications in chemical and biological research.
Formula:C14H9BrCl2O3
InChI:InChI=1S/C14H9BrCl2O3/c15-9-2-4-13(10(6-9)14(18)19)20-7-8-1-3-11(16)12(17)5-8/h1-6H,7H2,(H,18,19)
InChI key:InChIKey=AQSNYZANMRDLGJ-UHFFFAOYSA-N
SMILES:O(CC1=CC(Cl)=C(Cl)C=C1)C2=C(C(O)=O)C=C(Br)C=C2
Synonyms:
  • 5-Bromo-2-[(3,4-dichlorophenyl)methoxy]benzoic acid
  • Benzoic acid, 5-bromo-2-[(3,4-dichlorophenyl)methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.