CAS 62178-61-4
:1-(2-propylpyridin-4-yl)-1-sulfinylmethanamine
Description:
1-(2-Propylpyridin-4-yl)-1-sulfinylmethanamine, with the CAS number 62178-61-4, is a chemical compound characterized by its unique structural features. It contains a pyridine ring substituted with a propyl group at the 2-position and a sulfinylmethanamine functional group. This compound is likely to exhibit properties typical of both amines and sulfoxides, including potential basicity due to the amine group and possible reactivity associated with the sulfinyl moiety. The presence of the pyridine ring suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the compound may possess biological activity, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, and it may exhibit different behaviors in various environments. Overall, this compound's unique structure positions it as a potentially valuable substance in both synthetic and medicinal chemistry contexts.
Formula:C9H12N2OS
InChI:InChI=1/C9H12N2OS/c1-2-3-8-6-7(4-5-11-8)9(10)13-12/h4-6H,2-3,10H2,1H3
SMILES:CCCc1cc(ccn1)C(=S=O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

