CAS 62182-11-0
:4-fluoro-4-deoxy-D-glucose
Description:
4-Fluoro-4-deoxy-D-glucose is a synthetic analog of glucose, where a fluorine atom replaces the hydroxyl group at the fourth carbon position. This modification alters its biochemical properties, making it a useful compound in various research applications, particularly in the study of glucose metabolism and transport. The presence of the fluorine atom can affect the compound's interaction with glucose transporters and enzymes, potentially inhibiting or modifying their activity. As a monosaccharide, it retains the basic structure of glucose, which includes a six-membered ring and multiple hydroxyl groups, although one is absent due to the deoxy modification. This compound is often utilized in biochemical assays and as a tracer in metabolic studies, particularly in the context of cancer research and diabetes. Its unique properties also make it a candidate for further exploration in drug development and therapeutic applications. Safety and handling precautions should be observed, as with any chemical substance, to mitigate any potential hazards associated with its use.
Formula:C6H11FO5
InChI:InChI=1/C6H11FO5/c7-3-2(1-8)12-6(11)5(10)4(3)9/h2-6,8-11H,1H2/t2-,3-,4+,5-,6-/m1/s1
Synonyms:- 4-deoxy-4-fluoro-beta-D-glucopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Deoxy-4-fluoro-a-D-glucopyranose
CAS:4-Deoxy-4-fluoro-a-D-glucopyranose is a carbohydrate that belongs to the group of carbohydrates. It has enthalpy and entropy values of -1,865.2 kJ/mol and -3,363.6 J/(mol·K) at 298 K, respectively. This compound has been shown to interact with water molecules in solution phase. 4-Deoxy-4-fluoro-a-D-glucopyranose is soluble in water and interacts with other carbohydrate molecules at an intermolecular level. 4DFA has an extrapolated melting point of about 216 degrees Celsius.
Formula:C6H11FO5Purity:Min. 95%Molecular weight:182.15 g/mol
