CAS 6219-55-2

1-(4-nitrophenyl)-1H-1,2,4-triazole

Description:

1-(4-Nitrophenyl)-1H-1,2,4-triazole, with the CAS number 6219-55-2, is an organic compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a nitrophenyl group, which contributes to its chemical reactivity and potential applications. It is typically a crystalline solid and may exhibit properties such as moderate solubility in organic solvents. The presence of the nitro group can impart unique electronic properties, making it useful in various chemical reactions, including those in medicinal chemistry and agrochemicals. Additionally, compounds like this one are often studied for their biological activities, including potential antifungal or herbicidal properties. Safety data should be consulted for handling, as nitro compounds can be sensitive and may pose health risks. Overall, 1-(4-nitrophenyl)-1H-1,2,4-triazole is a significant compound in research and industrial applications due to its structural characteristics and reactivity.

Formula: C₈H₆N₄O₂

InChI: InChI=1/C8H6N4O2/c13-12(14)8-3-1-7(2-4-8)11-6-9-5-10-11/h1-6H

SMILES: c1cc(ccc1n1cncn1)N(=O)=O

Synonyms:

• 1H-1,2,4-triazole, 1-(4-nitrophenyl)-

1-(4-Nitrophenyl)-1H-1,2,4-triazole

CAS: 6219-55-2

Formula: C₈H₆N₄O₂

Purity: %

Color and Shape: Solid

Molecular weight: 190.1588

Ref: IN-DA00ED1J

1-(4-Nitrophenyl)-1H-1,2,4-triazole

CAS: 6219-55-2

1-(4-Nitrophenyl)-1H-1,2,4-triazole

Purity: 95+%

Ref: 54-OR1038401

1-(4-Nitrophenyl)-1H-1,2,4-triazole

CAS: 6219-55-2

Purity: 95+%

Molecular weight: 190.1620026

Ref: 10-F726582