CAS 6219-66-5
:7-Acetyl-6-ethyl-9,10-dihydro-3,5,8-trihydroxy-9,10-dioxo-1,2-anthracenedicarboxylic acid
Description:
7-Acetyl-6-ethyl-9,10-dihydro-3,5,8-trihydroxy-9,10-dioxo-1,2-anthracenedicarboxylic acid, with CAS number 6219-66-5, is a complex organic compound belonging to the anthraquinone family. This substance features multiple functional groups, including acetyl, ethyl, and hydroxyl groups, contributing to its chemical reactivity and potential biological activity. The presence of dioxo groups indicates that it may participate in redox reactions, while the carboxylic acid moieties suggest acidic properties. The compound's structure allows for potential interactions with biological systems, making it of interest in pharmaceutical and biochemical research. Its solubility characteristics may vary depending on the solvent, influenced by the hydrophilic hydroxyl and carboxylic acid groups. Additionally, the compound may exhibit fluorescence properties, typical of many anthraquinone derivatives, which can be utilized in various applications, including dyeing and as indicators in analytical chemistry. Overall, the unique structural features of this compound make it a subject of interest for further study in both synthetic and applied chemistry contexts.
Formula:C20H14O10
InChI:InChI=1S/C20H14O10/c1-3-6-9(5(2)21)17(25)14-13(15(6)23)16(24)7-4-8(22)11(19(27)28)12(20(29)30)10(7)18(14)26/h4,22-23,25H,3H2,1-2H3,(H,27,28)(H,29,30)
InChI key:InChIKey=RHAXKFFKGZJUOE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(C(=O)C=3C(C2=O)=C(O)C(C(C)=O)=C(CC)C3O)=CC(O)=C1C(O)=O
Synonyms:- NSC 30555
- NSC 170008
- 7-Acetyl-6-ethyl-9,10-dihydro-3,5,8-trihydroxy-9,10-dioxo-1,2-anthracenedicarboxylic acid
- 1,2-Anthracenedicarboxylic acid, 7-acetyl-6-ethyl-9,10-dihydro-3,5,8-trihydroxy-9,10-dioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
