CAS 62208-67-7

3-amino-1-benzofuran-2-carbonitrile

Description:

3-Amino-1-benzofuran-2-carbonitrile is an organic compound characterized by its unique structure, which includes a benzofuran moiety and a cyano group. The presence of the amino group contributes to its potential as a building block in medicinal chemistry, as it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound typically exhibits moderate solubility in polar organic solvents, which is influenced by the functional groups present. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds targeting specific biological pathways. The compound's CAS number, 62208-67-7, allows for easy identification in chemical databases and literature. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, 3-amino-1-benzofuran-2-carbonitrile is a versatile compound with potential applications in various fields, including organic synthesis and drug development.

Formula: C₉H₆N₂O

InChI: InChI=1/C9H6N2O/c10-5-8-9(11)6-3-1-2-4-7(6)12-8/h1-4H,11H2

SMILES: c1ccc2c(c1)c(c(C#N)o2)N

Synonyms:

• 2-Benzofurancarbonitrile, 3-Amino-

3-Amino-1-benzofuran-2-carbonitrile

CAS: 62208-67-7

Formula: C₉H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 158.1567

Ref: IN-DA00EEDY

3-Amino-1-benzofuran-2-carbonitrile

CAS: 62208-67-7

3-Amino-1-benzofuran-2-carbonitrile

Purity: 97%

Molecular weight: 158.16g/mol

Ref: 54-OR941653

3-amino-1-benzofuran-2-carbonitrile

CAS: 62208-67-7

Formula: C₉H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 158.16

Ref: 10-F312951

3-Amino-1-benzofuran-2-carbonitrile

CAS: 62208-67-7

3-Amino-1-benzofuran-2-carbonitrile is a heterocyclic compound that belongs to the isothiocyanate family. It has been shown to be an analog of phenyl isothiocyanate by x-ray crystallography, and it reacts with selenium dioxide in a 1:1 ratio to form selenides. The reaction mechanism is believed to be analogous to the reaction of phenyl isothiocyanate, although this has not yet been confirmed. The reaction proceeds with a refluxing pyridine as solvent, which crystallizes on cooling.

Formula: C₉H₆N₂O

Purity: Min. 95%

Molecular weight: 158.16 g/mol

Ref: 3D-MCA20867