CAS 6221-62-1

Bicyclo[3.3.1]nonane-3-carboxylic acid

Description:

Bicyclo[3.3.1]nonane-3-carboxylic acid, with the CAS number 6221-62-1, is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of two fused cyclohexane rings and a carboxylic acid functional group. This compound exhibits a rigid, three-dimensional conformation due to the constraints of its bicyclic framework, influencing its reactivity and interactions with other molecules. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the bicyclic structure can affect the compound's physical properties, including melting and boiling points, solubility, and stability. Bicyclo[3.3.1]nonane-3-carboxylic acid may also exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and materials science. Its unique structural features and functional group make it a valuable compound for further research and potential applications in various fields.

Formula: C₁₀H₁₆O₂

InChI: InChI=1S/C10H16O2/c11-10(12)9-5-7-2-1-3-8(4-7)6-9/h7-9H,1-6H2,(H,11,12)

InChI key: InChIKey=XJKUZAYHWMSZNC-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC2CC(C1)CCC2

Synonyms:

• Bicyclo[3.3.1]nonane-3-carboxylic acid

Bicyclo[3.3.1]nonane-3-carboxylic acid

CAS: 6221-62-1

Versatile small molecule scaffold

Formula: C₁₀H₁₆O₂

Purity: Min. 95%

Molecular weight: 168.23 g/mol

Ref: 3D-GAA22162