CAS 6221-65-4

Bicyclo[3.2.1]octane-3-carboxylic acid

Description:

Bicyclo[3.2.1]octane-3-carboxylic acid is a bicyclic organic compound characterized by its unique structure, which consists of a bicyclo[3.2.1]octane framework with a carboxylic acid functional group at the 3-position. This compound features a rigid, three-dimensional arrangement that contributes to its distinctive chemical properties. The presence of the carboxylic acid group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the bicyclic structure can influence the compound's reactivity, steric hindrance, and potential interactions with biological systems. Bicyclo[3.2.1]octane-3-carboxylic acid may also exhibit interesting physical properties, including solubility in polar solvents and potential applications in organic synthesis or as a building block in the development of pharmaceuticals. Its unique structural features make it a subject of interest in both synthetic organic chemistry and materials science.

Formula: C₉H₁₄O₂

InChI: InChI=1S/C9H14O2/c10-9(11)8-4-6-1-2-7(3-6)5-8/h6-8H,1-5H2,(H,10,11)

InChI key: InChIKey=KTEWGIIYPCRLJJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC2CC(C1)CC2

Synonyms:

• Bicyclo[3.2.1]octane-3-carboxylic acid

bicyclo[3.2.1]octane-3-carboxylic acid

CAS: 6221-65-4

Formula: C₉H₁₄O₂

Purity: 97%

Molecular weight: 154.2063

Ref: IN-DA01DZV7

Bicyclo[3.2.1]octane-3-carboxylic acid

CAS: 6221-65-4

Purity: 97%

Molecular weight: 154.2089996

Ref: 10-F624664

Bicyclo[3.2.1]octane-3-carboxylic acid

CAS: 6221-65-4

Versatile small molecule scaffold

Formula: C₉H₁₄O₂

Purity: Min. 95%

Molecular weight: 154.21 g/mol

Ref: 3D-GAA22165