CAS 62218-04-6

[1,1′:3′,1′′-Terphenyl]-2,2′,2′′,4,4′,4′′,6,6′,6′′-nonol

Description:

[1,1′:3′,1′′-Terphenyl]-2,2′,2′′,4,4′,4′′,6,6′,6′′-nonol, with CAS number 62218-04-6, is a complex organic compound characterized by its structure, which consists of three phenyl rings connected in a specific arrangement, along with multiple hydroxyl (-OH) groups. This compound exhibits properties typical of polyphenolic substances, including potential antioxidant activity due to the presence of hydroxyl groups, which can donate hydrogen atoms to free radicals. It is generally insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. The presence of multiple hydroxyl groups can also influence its reactivity, making it a candidate for various chemical reactions, including esterification and etherification. Additionally, its structural characteristics may impart unique thermal and photophysical properties, making it of interest in materials science and organic electronics. Overall, [1,1′:3′,1′′-Terphenyl]-2,2′,2′′,4,4′,4′′,6,6′,6′′-nonol is a notable compound in the study of organic chemistry and materials.

Formula: C₁₈H₁₄O₉

InChI: InChI=1S/C18H14O9/c19-6-1-8(21)14(9(22)2-6)16-12(25)5-13(26)17(18(16)27)15-10(23)3-7(20)4-11(15)24/h1-5,19-27H

InChI key: InChIKey=COTZPIUJHGYKAQ-UHFFFAOYSA-N

SMILES: OC1=C(C(O)=CC(O)=C1C2=C(O)C=C(O)C=C2O)C3=C(O)C=C(O)C=C3O

Synonyms:

• 1,5-Bis(2,4,6-trihydroxyphenyl)-2,4,6-trihydroxybenzene
• Trifucol
• [1,1′:3′,1′′-Terphenyl]-2,2′,2′′,4,4′,4′′,6,6′,6′′-nonol

Phloroglucinol Impurity 2

CAS: 62218-04-6

Formula: C₁₈H₁₄O₉

Molecular weight: 374.30

Ref: 4Z-P-249050