CAS 62224-24-2
:Methyl 4,5-dibromothiophene-2-carboxylate
Description:
Methyl 4,5-dibromothiophene-2-carboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features two bromine substituents at the 4 and 5 positions of the thiophene ring, contributing to its reactivity and potential applications in organic synthesis and materials science. The presence of the carboxylate group, specifically the methyl ester, at the 2 position enhances its solubility in organic solvents and may influence its biological activity. Methyl 4,5-dibromothiophene-2-carboxylate is typically a solid at room temperature and may exhibit distinct color and odor characteristics. Its molecular structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in the synthesis of more complex organic molecules. Additionally, the bromine atoms can serve as sites for further functionalization, expanding its utility in the development of pharmaceuticals, agrochemicals, and advanced materials. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C6H4Br2O2S
InChI:InChI=1/C6H4Br2O2S/c1-10-6(9)4-2-3(7)5(8)11-4/h2H,1H3
SMILES:COC(=O)c1cc(c(Br)s1)Br
Synonyms:- 2-Thiophenecarboxylic Acid, 4,5-Dibromo-, Methyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 4,5-dibromothiophene-2-carboxylate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H4Br2O2SPurity:97%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:299.96Methyl4,5-dibromothiophene-2-carboxylate
CAS:Formula:C6H4Br2O2SPurity:95%Color and Shape:SolidMolecular weight:299.9678Methyl 4,5-dibromothiophene-2-carboxylate
CAS:Methyl 4,5-dibromothiophene-2-carboxylatePurity:95%Color and Shape:White SolidMolecular weight:299.97g/mol



