CAS 6223-36-5
:Ethyl 3,8-dimethyl-5-(1-methylethyl)-1-azulenesulfonate
Description:
Ethyl 3,8-dimethyl-5-(1-methylethyl)-1-azulenesulfonate is a chemical compound characterized by its azulene structure, which is a bicyclic aromatic hydrocarbon known for its distinct blue color and unique electronic properties. This compound features a sulfonate group, which enhances its solubility in polar solvents and can influence its reactivity. The presence of multiple methyl groups contributes to its steric bulk and can affect its physical properties, such as boiling point and melting point. Ethyl groups typically indicate that the compound may be a liquid at room temperature, and the sulfonate moiety suggests potential applications in organic synthesis or as a reagent in various chemical reactions. The compound's specific reactivity and applications would depend on its functional groups and overall molecular structure, making it of interest in fields such as organic chemistry and materials science. However, detailed information regarding its toxicity, stability, and specific applications would require further investigation and analysis.
Formula:C17H22O3S
InChI:InChI=1S/C17H22O3S/c1-6-20-21(18,19)16-9-13(5)15-10-14(11(2)3)8-7-12(4)17(15)16/h7-11H,6H2,1-5H3
InChI key:InChIKey=RBHFPIHDGCGQPN-UHFFFAOYSA-N
SMILES:S(OCC)(=O)(=O)C=1C=2C(C=C(C(C)C)C=CC2C)=C(C)C1
Synonyms:- Ethyl 3,8-dimethyl-5-(1-methylethyl)-1-azulenesulfonate
- 1-Azulenesulfonic acid, 3,8-dimethyl-5-(1-methylethyl)-, ethyl ester
- 1-Azulenesulfonic acid, 5-isopropyl-3,8-dimethyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

