CAS 62247-48-7
:1-(4-chlorophenyl)-3-[N-[6-[[N-[(4-chlorophenyl)carbamoyl]carbamimidoyl]amino]hexyl]carbamimidoyl]urea
Description:
1-(4-chlorophenyl)-3-[N-[6-[[N-[(4-chlorophenyl)carbamoyl]carbamimidoyl]amino]hexyl]carbamimidoyl]urea, with the CAS number 62247-48-7, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as urea and carbamimidoyl moieties. This compound features a 4-chlorophenyl group, which contributes to its potential biological activity and lipophilicity. The presence of multiple nitrogen atoms in the structure suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which are critical for its application in research or pharmaceutical development. The compound's synthesis typically involves multi-step reactions, highlighting its complexity. Additionally, its potential uses may include roles in drug development or as a biochemical probe, although specific applications would depend on further research into its pharmacological properties and mechanisms of action. Safety and handling precautions are essential due to the presence of chlorinated and nitrogen-containing groups, which may pose health risks.
Formula:C22H28Cl2N8O2
InChI:InChI=1/C22H28Cl2N8O2/c23-15-5-9-17(10-6-15)29-21(33)31-19(25)27-13-3-1-2-4-14-28-20(26)32-22(34)30-18-11-7-16(24)8-12-18/h5-12H,1-4,13-14H2,(H4,25,27,29,31,33)(H4,26,28,30,32,34)
SMILES:C(CCCNC(=N)N=C(Nc1ccc(cc1)Cl)O)CCNC(=N)N=C(Nc1ccc(cc1)Cl)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Chlorhexidine Diacetate Impurity C
CAS:Controlled ProductImpurity Chlorhexidine Diacetate EP Impurity C
Applications An impurity standard for Chlorhexidine.Formula:C22H28Cl2N8O2Color and Shape:NeatMolecular weight:507.4161Chlorhexidine diacetate impurity C
CAS:Chlorhexidine diacetate impurity C is a crystalline solid with an ionic crystal structure. It belongs to the class of hydroxy-substituted quinolinium salts, which are related to a type of nonlinear optical material known as hyperpolarizability. The molecule has a centrosymmetric crystal system and can be classified as a macroscopic supramolecular ionic crystal. Chlorhexidine diacetate impurity C has been shown to have the ability to act as an optical polarizer. The molecule's optical properties are determined by the presence of a hydroxyl group and its location on the central ring (the quinolinium).Formula:C22H28Cl2N8O2Purity:Min. 95%Molecular weight:507.42 g/mol



