CymitQuimica logo

CAS 62259-92-1

:

Pyrido[3,4-d]pyrimidin-4(1H)-one,5,6,7,8-tetrahydro-2-methyl-7-(phenylmethyl)-

Description:
Pyrido[3,4-d]pyrimidin-4(1H)-one, 5,6,7,8-tetrahydro-2-methyl-7-(phenylmethyl)- is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings. This compound features a tetrahydro structure, indicating the presence of a saturated ring system, and includes a methyl group and a phenylmethyl substituent, which contribute to its unique chemical properties. The presence of the pyridine and pyrimidine moieties suggests potential biological activity, as many compounds containing these structures are known for their pharmacological effects. The compound's molecular structure may exhibit various functional groups that can participate in hydrogen bonding and other interactions, influencing its solubility and reactivity. Additionally, the presence of the phenylmethyl group may enhance lipophilicity, potentially affecting its bioavailability. Overall, this compound's characteristics make it of interest in medicinal chemistry and drug development, although specific applications would depend on further research into its biological activity and interactions.
Formula:C15H17N3O
InChI:InChI=1S/C15H17N3O/c1-11-16-14-10-18(8-7-13(14)15(19)17-11)9-12-5-3-2-4-6-12/h2-6H,7-10H2,1H3,(H,16,17,19)
InChI key:HSHFWFQDSHKRIT-UHFFFAOYSA-N
SMILES:CC1=NC2=C(CCN(C2)CC3=CC=CC=C3)C(=O)N1
Found 5 products.