CAS 62261-58-9

(3-aminophenyl)(3,4-dimethylphenyl)methanone

Description:

(3-aminophenyl)(3,4-dimethylphenyl)methanone, with the CAS number 62261-58-9, is an organic compound characterized by its structure, which includes an amine group and a ketone functional group. This compound features a phenyl ring substituted with an amino group at the meta position and another phenyl ring that is further substituted with two methyl groups at the 3 and 4 positions. The presence of the amino group suggests potential basic properties and the ability to participate in hydrogen bonding, while the ketone group contributes to its reactivity, particularly in nucleophilic addition reactions. The methyl substitutions can influence the compound's steric hindrance and electronic properties, potentially affecting its solubility and reactivity. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its unique structural features that could impart specific biological or chemical activities. As with many organic compounds, safety and handling precautions should be observed, as the compound may exhibit toxicity or other hazardous properties.

Formula: C₁₅H₁₅NO

InChI: InChI=1/C15H15NO/c1-10-6-7-13(8-11(10)2)15(17)12-4-3-5-14(16)9-12/h3-9H,16H2,1-2H3

SMILES: Cc1ccc(cc1C)C(=O)c1cccc(c1)N

Synonyms:

• Methanone, (3-Aminophenyl)(3,4-Dimethylphenyl)-

(3-aminophenyl)(3,4-dimethylphenyl)methanone

CAS: 62261-58-9

Formula: C₁₅H₁₅NO

Purity: 95.0%

Molecular weight: 225.291

Ref: 10-F313956