CAS 62265-67-2
:2,2-Dichloro-1-(3,4-dihydro-6-hydroxy-1(2H)-quinolinyl)ethanone
Description:
2,2-Dichloro-1-(3,4-dihydro-6-hydroxy-1(2H)-quinolinyl)ethanone, identified by its CAS number 62265-67-2, is a chemical compound that features a dichloroethanone moiety linked to a quinoline derivative. This compound exhibits characteristics typical of both halogenated organic compounds and heterocyclic compounds. The presence of chlorine atoms contributes to its reactivity and potential biological activity, while the quinoline structure may impart pharmacological properties, such as antimicrobial or anti-inflammatory effects. The hydroxyl group in the quinoline ring enhances its solubility in polar solvents and may participate in hydrogen bonding, influencing its interactions in biological systems. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Its stability, solubility, and reactivity can vary based on environmental conditions, making it important to consider these factors in practical applications. Overall, this compound represents a unique intersection of organic chemistry and pharmacology, warranting further investigation into its properties and potential uses.
Formula:C11H11Cl2NO2
InChI:InChI=1S/C11H11Cl2NO2/c12-10(13)11(16)14-5-1-2-7-6-8(15)3-4-9(7)14/h3-4,6,10,15H,1-2,5H2
InChI key:InChIKey=OMZBOXOCCLZODD-UHFFFAOYSA-N
SMILES:C(C(Cl)Cl)(=O)N1C=2C(=CC(O)=CC2)CCC1
Synonyms:- 1-(Dichloroacetyl)-1,2,3,4-tetrahydro-6-quinolinol
- 2,2-Dichloro-1-(3,4-dihydro-6-hydroxy-1(2H)-quinolinyl)ethanone
- 6-Quinolinol, 1-(dichloroacetyl)-1,2,3,4-tetrahydro-
- 2,2-Dichloro-1-(6-hydroxy-3,4-dihydro-2H-quinolin-1-yl)ethanone
- 1-(Dichloroacetyl)-1,2,3,4-tetrahydroquinolin-6-ol
- Ethanone, 2,2-dichloro-1-(3,4-dihydro-6-hydroxy-1(2H)-quinolinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Quinfamide Impurity 1
CAS:Formula:C11H11Cl2NO2Color and Shape:White To Off-White SolidMolecular weight:260.111-(Dichloroacetyl)-1,2,3,4-tetrahydro-6-quinolinol
CAS:Applications Main Quinfamide (Q670600) metabolite.
References Bailey, D., et al.: J. Med. Chem., 22, 599 (1979),Formula:C11H11Cl2NO2Color and Shape:NeatMolecular weight:260.12

