CymitQuimica logo

CAS 62281-15-6

:

1-(1-butylpiperidin-4-yl)methanamine dihydrochloride

Description:
1-(1-butylpiperidin-4-yl)methanamine dihydrochloride, with the CAS number 62281-15-6, is a chemical compound characterized by its piperidine structure, which includes a butyl group attached to the nitrogen atom of the piperidine ring. This compound is a dihydrochloride salt, indicating that it exists in a protonated form, which enhances its solubility in water and other polar solvents. It typically appears as a white crystalline solid. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. As with many amines, it may also exhibit hygroscopic properties, absorbing moisture from the air. Safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.
Formula:C10H24Cl2N2
InChI:InChI=1/C10H22N2.2ClH/c1-2-3-6-12-7-4-10(9-11)5-8-12;;/h10H,2-9,11H2,1H3;2*1H
InChI key:NTGFOFLKWPFVPS-UHFFFAOYSA-N
SMILES:CCCCN1CCC(CC1)CN.Cl.Cl
Synonyms:
  • 4-Piperidinemethanamine, 1-butyl-, hydrochloride (1:2)
  • 1-(1-Butylpiperidin-4-yl)methanamine dihydrochloride
Found 3 products.