CAS 622864-54-4
:9-hydroxy-4-phenylpyrrolo[3,4-c]carbazole-1,3(2H,6H)-dione
Description:
9-Hydroxy-4-phenylpyrrolo[3,4-c]carbazole-1,3(2H,6H)-dione, with CAS number 622864-54-4, is a synthetic organic compound characterized by its complex polycyclic structure, which includes a pyrrolo[3,4-c]carbazole framework. This compound features a hydroxyl group at the 9-position and a phenyl substituent at the 4-position, contributing to its unique chemical properties. It is known for its potential biological activities, including antitumor and antimicrobial effects, making it of interest in medicinal chemistry. The presence of the dione functional groups indicates that it can participate in various chemical reactions, such as nucleophilic additions or redox reactions. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and development. Overall, this compound represents a fascinating area of study due to its structural complexity and potential therapeutic applications.
Formula:C20H12N2O3
InChI:InChI=1/C20H12N2O3/c23-11-6-7-14-13(8-11)16-15(21-14)9-12(10-4-2-1-3-5-10)17-18(16)20(25)22-19(17)24/h1-9,21,23H,(H,22,24,25)
SMILES:c1ccc(cc1)c1cc2c(c3cc(ccc3[nH]2)O)c2c1C(=NC2=O)O
Synonyms:- Pyrrolo[3,4-c]carbazole-1,3(2H,6H)-dione, 9-hydroxy-4-phenyl-
- Pd0407824
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
PD 407824
CAS:PD 407824 is a chemical BMP sensitiser that promotes increased cellular sensitivity to subthreshold amounts of BMP4.PD 407824 is a potent inhibitor of the checkpoint kinases Chk1 and WEE1 (IC50s: 47 and 97 nM, respectively).Formula:C20H12N2O3Purity:98.02%Color and Shape:SolidMolecular weight:328.32PD 407824
CAS:PD 407824 is a small molecule that acts as a chaperone and functions in the cell cycle. PD 407824 has been shown to inhibit the growth of tumor cells in vitro by interfering with their ability to proliferate. This agent also inhibits the expression of epidermal growth factor (EGF) and, therefore, slows down tumor cell proliferation. PD 407824 inhibits cancer cell viability and increases apoptosis in vitro. It also induces the expression of colony-stimulating factors (CSFs), which may contribute to its anti-tumor effects. The mechanism by which PD 407824 works is not yet known, but it is thought to be due to inhibition of signaling pathways downstream of growth factor receptors.Formula:C20H12N2O3Purity:Min. 95%Molecular weight:328.32 g/mol




