CAS 622864-54-4: 9-hydroxy-4-phenylpyrrolo[3,4-c]carbazole-1,3(2H,6H)-dione
Description:9-Hydroxy-4-phenylpyrrolo[3,4-c]carbazole-1,3(2H,6H)-dione, with CAS number 622864-54-4, is a synthetic organic compound characterized by its complex polycyclic structure, which includes a pyrrolo[3,4-c]carbazole framework. This compound features a hydroxyl group at the 9-position and a phenyl substituent at the 4-position, contributing to its unique chemical properties. It is known for its potential biological activities, including antitumor and antimicrobial effects, making it of interest in medicinal chemistry. The presence of the dione functional groups indicates that it can participate in various chemical reactions, such as nucleophilic additions or redox reactions. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and development. Overall, this compound represents a fascinating area of study due to its structural complexity and potential therapeutic applications.
Formula:C20H12N2O3
InChI:InChI=1/C20H12N2O3/c23-11-6-7-14-13(8-11)16-15(21-14)9-12(10-4-2-1-3-5-10)17-18(16)20(25)22-19(17)24/h1-9,21,23H,(H,22,24,25)
- Synonyms:
- Pyrrolo[3,4-c]carbazole-1,3(2H,6H)-dione, 9-hydroxy-4-phenyl-
- Pd0407824
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | PD-407824 REF: 7W-GL0112CAS: 622864-54-4 | - - - | To inquire | Mon 21 Apr 25 |
![]() | PD 407824 REF: TM-T16446CAS: 622864-54-4 | 98.02% | To inquire | Tue 22 Apr 25 |
![]() | PD 407824 REF: 3D-BP161386CAS: 622864-54-4 | Min. 95% | To inquire | Mon 28 Apr 25 |
![]() | PD-407824 REF: TR-P218280CAS: 622864-54-4 | - - - | 9,788.00 € | Wed 28 May 25 |

PD 407824
Ref: TM-T16446
1mg | 75.00 € |

PD 407824
Ref: 3D-BP161386
Undefined size | To inquire |

PD-407824
Controlled ProductRef: TR-P218280
500mg | 9,788.00 € |