CAS 62289-81-0

N-3-Pyridinyl-2-thiophenecarboxamide

Description:

N-3-Pyridinyl-2-thiophenecarboxamide, identified by its CAS number 62289-81-0, is a chemical compound that features a pyridine ring and a thiophene ring, which are both heterocyclic aromatic compounds. This substance typically exhibits characteristics such as being a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals due to its unique structural properties. The presence of the carboxamide functional group suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the pyridinyl and thiophenyl substituents can impart specific electronic properties, making it a candidate for various chemical reactions or interactions. The compound's molecular structure may also contribute to its biological activity, which could be of interest in medicinal chemistry. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-3-Pyridinyl-2-thiophenecarboxamide represents a versatile compound with potential utility in various chemical and biological applications.

Formula: C₁₀H₈N₂OS

InChI: InChI=1S/C10H8N2OS/c13-10(9-4-2-6-14-9)12-8-3-1-5-11-7-8/h1-7H,(H,12,13)

InChI key: InChIKey=UPLHUDRMLWWFRE-UHFFFAOYSA-N

SMILES: C(NC=1C=CC=NC1)(=O)C2=CC=CS2

Synonyms:

• 2-Thiophenecarboxamide, N-3-pyridinyl-
• SW 106065
• N-3-Pyridinyl-2-thiophenecarboxamide

2-Thiophenecarboxamide, N-3-pyridinyl-

CAS: 62289-81-0

Formula: C₁₀H₈N₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 204.2483

Ref: IN-DA01J40I

SW106065

CAS: 62289-81-0

SW106065

Purity: ≥98%

Molecular weight: 204.25g/mol

Ref: 54-BUP02516

SW106065

CAS: 62289-81-0

SW106065 is a novel pharmacologic inducer of apoptosis in MPNST (malignant peripheral nerve sheath tumors). SW106065 inhibits ATP consumption of sMPNST.

Formula: C₁₀H₈N₂OS

Purity: 99.97%

Color and Shape: Solid

Molecular weight: 204.25

Ref: TM-T8762