CymitQuimica logo

CAS 62295-16-3

:

(3E)-1-ethyl-3-hydrazono-1,3-dihydro-2H-indol-2-one

Description:
(3E)-1-ethyl-3-hydrazono-1,3-dihydro-2H-indol-2-one, with the CAS number 62295-16-3, is a chemical compound that belongs to the class of indole derivatives. This substance features a hydrazone functional group, which is characterized by the presence of a hydrazine moiety (–NH–NH–) linked to a carbonyl group. The compound exhibits a bicyclic structure typical of indoles, contributing to its potential biological activity. It is generally characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many indole derivatives. The presence of the ethyl group and the hydrazone linkage may impart specific reactivity and stability characteristics, making it of interest in medicinal chemistry and organic synthesis. Additionally, compounds of this type may exhibit various pharmacological properties, including anti-inflammatory or antimicrobial activities, although specific biological data would need to be referenced for detailed applications. As with all chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C10H11N3O
InChI:InChI=1/C10H11N3O/c1-2-13-8-6-4-3-5-7(8)9(12-11)10(13)14/h3-6H,2,11H2,1H3/b12-9+
Found 1 products.