CAS 623-55-2

5-methylhexan-3-ol

Description:

5-Methylhexan-3-ol, with the CAS number 623-55-2, is an organic compound classified as a tertiary alcohol. It features a six-carbon chain with a hydroxyl (-OH) group attached to the third carbon and a methyl group on the fifth carbon. This structure contributes to its unique properties, including a moderate boiling point and solubility in organic solvents. The compound is typically colorless and has a characteristic odor, making it useful in various applications, including as a flavoring agent and in the synthesis of other chemicals. Its molecular formula is C7H16O, indicating it has seven carbon atoms, sixteen hydrogen atoms, and one oxygen atom. 5-Methylhexan-3-ol is relatively stable under standard conditions but should be handled with care due to its potential flammability. Additionally, it may exhibit mild toxicity, necessitating appropriate safety measures during handling and use. Overall, this compound is of interest in both industrial and research settings due to its functional properties and versatility.

Formula: C₇H₁₆O

InChI: InChI=1/C7H16O/c1-4-7(8)5-6(2)3/h6-8H,4-5H2,1-3H3

SMILES: CCC(CC(C)C)O

Synonyms:

• 3-Hexanol, 5-methyl-
• 5-Methyl-3-hexanol