CAS 623-56-3
:5-Methyl-3-hexanone
Description:
5-Methyl-3-hexanone, with the CAS number 623-56-3, is a ketone characterized by its six-carbon chain and a methyl group at the fifth carbon position. This compound typically appears as a colorless liquid with a distinctive odor reminiscent of ketones. It has a moderate boiling point and is soluble in organic solvents, making it useful in various industrial applications, including as a solvent and in the synthesis of other organic compounds. The presence of the carbonyl group (C=O) in its structure contributes to its reactivity, allowing it to participate in nucleophilic addition reactions. Additionally, 5-Methyl-3-hexanone is flammable and should be handled with care, following appropriate safety protocols. Its physical and chemical properties, such as density and viscosity, can vary based on temperature and purity. Overall, this compound is significant in organic chemistry and industrial applications due to its functional group and structural characteristics.
Formula:C7H14O
InChI:InChI=1S/C7H14O/c1-4-7(8)5-6(2)3/h6H,4-5H2,1-3H3
InChI key:InChIKey=DXVYLFHTJZWTRF-UHFFFAOYSA-N
SMILES:C(CC(C)C)(CC)=O
Synonyms:- 2-Methyl-4-hexanone
- 3-Hexanone, 5-methyl-
- 5-Methyl-3-hexanone
- Ethyl Isobutyl Ketone
- Ethylisobutylketone
- Isobutyl ethyl ketone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-Methylhexan-3-one
CAS:5-Methylhexan-3-one is a ketone compound widely used in biochemical experiments and drug synthesis research.Formula:C7H14OColor and Shape:SolidMolecular weight:114.19Ethyl Isobutyl Ketone
CAS:Formula:C7H14OPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:114.19Ethyl isobutyl ketone
CAS:Ethyl isobutyl ketone, also known as acetone, belongs to the group of aliphatic ketones. It is a colorless and volatile liquid that has a sweet odor. Ethyl isobutyl ketone can be used in the synthesis of pharmaceuticals, dyes, and perfumes. In addition to this, it has shown to have properties of a solvent in organic chemistry and as an active oxygen source in electrochemical impedance spectroscopy. This product also has functional groups such as hydroxy and carbonyl groups that are responsible for its solvency in water and its viscosity. Nitro and hydroxyl groups on the other hand are responsible for its solvency in water vapor.
Formula:C7H14OPurity:Min. 95%Molecular weight:114.19 g/mol





