CAS 62302-28-7
:4-Pyridinemethanol, hydrochloride (1:1)
Description:
4-Pyridinemethanol, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound is typically encountered as a white to off-white crystalline solid, and it is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The molecular formula reflects the presence of both a hydroxymethyl group and a pyridine moiety, contributing to its potential applications in pharmaceuticals and organic synthesis. As a hydrochloride salt, it exhibits properties typical of ionic compounds, such as higher stability and ease of handling. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C6H7NO·ClH
InChI:InChI=1S/C6H7NO.ClH/c8-5-6-1-3-7-4-2-6;/h1-4,8H,5H2;1H
InChI key:InChIKey=NKBJHERHVXOEIR-UHFFFAOYSA-N
SMILES:C(O)C=1C=CN=CC1.Cl
Synonyms:- 4-Hydroxymethylpiperidinium chloride
- 4-Pyridine methanol hydrochloride
- 4-Pyridinemethanol, hydrochloride (1:1)
- Pyridin-4-Ylmethanol Hydrochloride
- 4-Pyridinemethanol, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
