CAS 62306-80-3

B-(5-Formyl-3-furanyl)boronic acid

Description:

B-(5-Formyl-3-furanyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a furan ring with an aldehyde substituent. This compound typically exhibits properties associated with both boronic acids and furan derivatives, including the ability to form reversible covalent bonds with diols, making it useful in various applications such as organic synthesis and medicinal chemistry. The furan moiety contributes to its reactivity and potential for participation in electrophilic aromatic substitution reactions. Additionally, the presence of the formyl group enhances its reactivity, allowing it to engage in further transformations, such as condensation reactions. B-(5-Formyl-3-furanyl)boronic acid may also exhibit solubility in polar organic solvents, which is common for boronic acids. Its unique structure allows for potential applications in the development of sensors, catalysts, and in the synthesis of complex organic molecules. As with many boronic acids, care should be taken in handling due to their sensitivity to moisture and air, which can affect their stability and reactivity.

Formula: C₅H₅BO₄

InChI: InChI=1S/C5H5BO4/c7-2-5-1-4(3-10-5)6(8)9/h1-3,8-9H

InChI key: InChIKey=RIBSTTPRQPAXRS-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C=C(C=O)OC1

Synonyms:

• (5-Formylfuran-3-Yl)Boronic Acid
• 2-Formyl-4-furanboronic acid
• 2-Formylfuran-4-boronic acid
• 5-Formyl-3-furanboronic acid
• B-(5-Formyl-3-furanyl)boronic acid
• Boronic acid, (5-formyl-3-furanyl)-
• Boronic acid, B-(5-formyl-3-furanyl)-

Boronic acid, (5-formyl-3-furanyl)-

CAS: 62306-80-3

Formula: C₅H₅BO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 139.9018

Ref: IN-DA00IB0D

2-Formylfuran-4-boronic acid

CAS: 62306-80-3

2-Formylfuran-4-boronic acid

Purity: 99%

Molecular weight: 139.90g/mol

Ref: 54-OR3662

5-Formylfuran-3-boronic acid

CAS: 62306-80-3

Formula: C₅H₅BO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 139.9

Ref: 10-F223484