
CAS 62306-81-4
:(2aS,4R,4aS,4bR,5aS,8S,8aS,10aR,10bR,14aS)-4-(Acetyloxy)-8-(3-furanyl)decahydro-2,2,4a,8a-tetramethyl-11H,13H-oxireno[d]pyrano[4′,3′:3,3a]isobenzofuro[5,4-f][2]benzopyran-3,6,13(4H,5aH)-trione
Description:
The chemical substance with the name "(2aS,4R,4aS,4bR,5aS,8S,8aS,10aR,10bR,14aS)-4-(Acetyloxy)-8-(3-furanyl)decahydro-2,2,4a,8a-tetramethyl-11H,13H-oxireno[d]pyrano[4′,3′:3,3a]isobenzofuro[5,4-f][2]benzopyran-3,6,13(4H,5aH)-trione" and CAS number "62306-81-4" is a complex organic compound characterized by its intricate polycyclic structure and multiple stereocenters, which contribute to its specific three-dimensional arrangement. This compound features functional groups such as an acetyloxy group and a furan moiety, indicating potential reactivity and biological activity. Its molecular framework suggests it may exhibit properties typical of natural products, possibly including antioxidant or anti-inflammatory effects. The presence of multiple rings and substituents implies a degree of rigidity in its structure, which can influence its solubility and interaction with biological targets. Additionally, the compound's stereochemistry is crucial for its biological activity, as the spatial arrangement of atoms can significantly affect how it interacts with enzymes or receptors in living organisms. Overall, this substance represents a fascinating example of complex organic chemistry with potential applications in pharmaceuticals or natural product chemistry.
Formula:C28H32O10
InChI:InChI=1S/C28H32O10/c1-13(29)35-21-18(31)19-24(2,3)37-16-10-17(30)34-12-27(16,19)15-6-8-25(4)20(14-7-9-33-11-14)36-23(32)22-28(25,38-22)26(15,21)5/h7,9,11,15-16,19-22H,6,8,10,12H2,1-5H3/t15-,16-,19+,20-,21-,22+,25-,26-,27-,28+/m0/s1
InChI key:InChIKey=YBJGIQUVRQCMSY-VZGSZHHKSA-N
SMILES:C[C@]12[C@]34[C@](C)([C@@H](OC(=O)[C@]3(O4)[H])C=5C=COC5)CC[C@@]1([C@]67[C@](C(=O)[C@@H]2OC(C)=O)(C(C)(C)O[C@]6(CC(=O)OC7)[H])[H])[H]
Synonyms:- 11H,13H-Oxireno[d]pyrano[4′,3′:3,3a]isobenzofuro[5,4-f][2]benzopyran-3,6,13(4H,5aH)-trione, 4-(acetyloxy)-8-(3-furanyl)decahydro-2,2,4a,8a-tetramethyl-, [2aS-(2aα,4α,4aα,4bS*,5aβ,8β,8aβ,10aβ,10bS*,14aβ)]-
- 11H,13H-Oxireno[d]pyrano[4′,3′:3,3a]isobenzofuro[5,4-f][2]benzopyran-3,6,13(4H,5aH)-trione, 4-(acetyloxy)-8-(3-furanyl)decahydro-2,2,4a,8a-tetramethyl-, (2aS,4R,4aS,4bR,5aS,8S,8aS,10aR,10bR,14aS)-
- Limonoic acid, 7-(acetyloxy)-7-deoxo-6-oxo-, di-δ-lactone, (5β,7β)-
- (2aS,4R,4aS,4bR,5aS,8S,8aS,10aR,10bR,14aS)-4-(Acetyloxy)-8-(3-furanyl)decahydro-2,2,4a,8a-tetramethyl-11H,13H-oxireno[d]pyrano[4′,3′:3,3a]isobenzofuro[5,4-f][2]benzopyran-3,6,13(4H,5aH)-trione
- Rutaevin monoacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Rutaevin 7-acetate
CAS:Rutaevin 7-acetate is a natural product for research related to life sciences. The catalog number is TN4929 and the CAS number is 62306-81-4.Formula:C28H32O10Purity:98%Color and Shape:SolidMolecular weight:528.55Rutaevin 7-acetate
CAS:Rutaevin 7-acetate is a naturally occurring flavonoid derivative that is isolated from specific plant species. It is primarily sourced from plants belonging to the Rutaceae family, known for their diverse range of bioactive compounds. The mode of action of Rutaevin 7-acetate involves modulating various biochemical pathways, potentially influencing enzyme activity and cell signaling processes, which may result in varied biological effects.Formula:C28H32O10Purity:Min. 95%Molecular weight:528.50 g/mol

