CAS 623143-43-1

(αR)-α-Methyl-2-thiazolemethanamine

Description:

(αR)-α-Methyl-2-thiazolemethanamine, with the CAS number 623143-43-1, is a chemical compound characterized by its thiazole ring structure, which contributes to its unique properties. This compound features an amino group, making it a potential candidate for various biological applications, including its role as a building block in pharmaceuticals. The presence of the methyl group at the alpha position enhances its lipophilicity, potentially influencing its interaction with biological membranes. Additionally, the thiazole moiety is known for its involvement in various chemical reactions and biological activities, including antimicrobial and antifungal properties. The stereochemistry indicated by the (αR) designation suggests specific spatial arrangements that can affect the compound's reactivity and biological activity. Overall, (αR)-α-Methyl-2-thiazolemethanamine is of interest in medicinal chemistry and may serve as a precursor for the synthesis of more complex molecules. Its characteristics make it a subject of study for researchers exploring new therapeutic agents.

Formula: C₅H₈N₂S

InChI: InChI=1S/C5H8N2S/c1-4(6)5-7-2-3-8-5/h2-4H,6H2,1H3/t4-/m1/s1

InChI key: InChIKey=DUOLTCNKKZZNIC-SCSAIBSYSA-N

SMILES: [C@H](C)(N)C1=NC=CS1

(R)-1-(Thiazol-2-yl)ethanamine

CAS: 623143-43-1

Formula: C₅H₉ClN₂S

Color and Shape: Solid

Molecular weight: 164.6564

Ref: IN-DA00EG1R

(R)-1-(Thiazol-2-yl)ethanamine dihydrochloride

CAS: 623143-43-1

Versatile small molecule scaffold

Formula: C₅H₈N₂S•(HCl)₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 200.66 g/mol

Ref: 3D-YZA14343

(R)-1-(Thiazol-2-yl)ethanamine hydrochloride

CAS: 623143-43-1

Formula: C₅H₉ClN₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.65

Ref: 10-F386227