
CAS 6232-20-8
:3-Cyano-D-alanine
Description:
3-Cyano-D-alanine is an amino acid derivative characterized by the presence of a cyano group (-C≡N) attached to the beta carbon of the alanine structure. This compound is a chiral molecule, existing in the D-configuration, which is significant in biochemical contexts, particularly in studies involving protein synthesis and enzyme interactions. The cyano group introduces unique reactivity, making 3-cyano-D-alanine a valuable intermediate in organic synthesis and a potential building block for various biochemical applications. It is typically a white to off-white crystalline solid, soluble in polar solvents, and exhibits stability under standard laboratory conditions. The presence of the cyano group can influence the compound's acidity and reactivity, allowing it to participate in nucleophilic addition reactions and other transformations. Additionally, 3-cyano-D-alanine may have implications in research related to metabolic pathways and the development of pharmaceuticals, particularly in the context of amino acid metabolism and neurochemistry. As with all chemical substances, proper handling and safety precautions should be observed due to potential toxicity and reactivity.
Formula:C4H6N2O2
InChI:InChI=1S/C4H6N2O2/c5-2-1-3(6)4(7)8/h3H,1,6H2,(H,7,8)/t3-/m1/s1
InChI key:InChIKey=BXRLWGXPSRYJDZ-GSVOUGTGSA-N
SMILES:[C@@H](CC#N)(C(O)=O)N
Synonyms:- D-3-Cyanoalanine
- β-Cyano-D-alanine
- 3-Cyano-D-alanine
- Alanine, 3-cyano-, D-
- D-Alanine, 3-cyano-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.