
CAS 62327-30-4
:4,4′-(1,2-Hydrazinediyl)bis[benzoic acid]
Description:
4,4′-(1,2-Hydrazinediyl)bis[benzoic acid], with the CAS number 62327-30-4, is an organic compound characterized by its hydrazine and benzoic acid functional groups. This compound features a hydrazine bridge connecting two benzoic acid moieties, which contributes to its potential as a ligand in coordination chemistry and as a building block in organic synthesis. The presence of the hydrazine group imparts unique reactivity, allowing for various chemical transformations, including oxidation and coupling reactions. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid groups. Its structure suggests potential applications in pharmaceuticals, materials science, and as a precursor for more complex organic molecules. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Overall, 4,4′-(1,2-Hydrazinediyl)bis[benzoic acid] is of interest for its versatile chemical behavior and potential applications in various fields of chemistry.
Formula:C14H12N2O4
InChI:InChI=1S/C14H12N2O4/c17-13(18)9-1-5-11(6-2-9)15-16-12-7-3-10(4-8-12)14(19)20/h1-8,15-16H,(H,17,18)(H,19,20)
InChI key:InChIKey=BSFRZXRXRVEMGS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(NNC2=CC=C(C(O)=O)C=C2)C=C1
Synonyms:- 4,4′-Hydrazodibenzoic acid
- Benzoic acid, 4,4′-hydrazobis-
- 4,4′-(1,2-Hydrazinediyl)bis[benzoic acid]
- Benzoic acid, 4,4′-(1,2-hydrazinediyl)bis-
- Benzoic acid, 4,4′-hydrazodi-
- 4,?4'-?(1,?2-?hydrazinediyl)?bis-Benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
