CAS 62345-76-0
:4-[2-(dimethylamino)ethoxy]aniline
Description:
4-[2-(Dimethylamino)ethoxy]aniline, with the CAS number 62345-76-0, is an organic compound characterized by its amine and ether functional groups. It features a dimethylamino group, which contributes to its basicity and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. The aniline portion of the molecule provides aromatic characteristics, which can influence its reactivity and stability. This compound is typically a colorless to light yellow liquid or solid, depending on its purity and form. It is often used in the synthesis of dyes, pharmaceuticals, and other organic compounds due to its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the ether linkage can affect its physical properties, such as boiling point and melting point, making it relevant in applications requiring specific thermal characteristics. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or absorbed through the skin.
Formula:C10H16N2O
InChI:InChI=1/C10H16N2O/c1-12(2)7-8-13-10-5-3-9(11)4-6-10/h3-6H,7-8,11H2,1-2H3
SMILES:CN(C)CCOc1ccc(cc1)N
Synonyms:- Benzenamine, 4-[2-(dimethylamino)ethoxy]-
- N-[2-(4-aminophenoxy)ethyl]-N,N-dimethylamine
- 4-(2-Dimethylaminoethoxy)aniline
- 4-[2-(Dimethylamino)ethoxy]aniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-[2-(DIMETHYLAMINO)ETHOXY]ANILINE 97
CAS:Formula:C10H16N2OPurity:97%Color and Shape:SolidMolecular weight:180.24684-[2-(Dimethylamino)ethoxy]aniline
CAS:4-[2-(Dimethylamino)ethoxy]anilineFormula:C10H16N2OPurity:97%Color and Shape: off-white crystalline needlesMolecular weight:180.25g/mol4-(2-Dimethylamino-ethoxy)-phenylamine
CAS:Controlled Product4-(2-Dimethylamino-ethoxy)-phenylamine is a synthetic, sustainable, membrane lipid that can form hydrophobic liposomes. These lipids are amphiphilic and form lamellar phases with one or two layers of molecules. The cavity in these phases can be filled with water, which may be useful for optical microscopy. The polymerase chain reaction (PCR) catalyzes the replication of DNA and RNA strands using 4-(2-dimethylamino-ethoxy)-phenylamine to coat the surface of the DNA template strand. This process allows for amplification of small amounts of target DNA sequences for research purposes.Formula:C10H16N2OPurity:Min. 95%Molecular weight:180.25 g/mol


