CAS 62348-13-4
:Isoxazole-5-carbonyl chloride
Description:
Isoxazole-5-carbonyl chloride is a chemical compound characterized by its isoxazole ring structure, which features a five-membered heterocyclic ring containing both nitrogen and oxygen atoms. This compound is typically used as an acyl chloride, making it a reactive intermediate in organic synthesis, particularly in the formation of amides and esters. Isoxazole-5-carbonyl chloride is known for its ability to participate in various chemical reactions, including nucleophilic acyl substitution, due to the electrophilic nature of the carbonyl carbon. It is generally a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is sensitive to moisture and should be handled under anhydrous conditions to prevent hydrolysis, which can lead to the formation of isoxazole-5-carboxylic acid. Safety precautions are necessary when working with this compound, as it can be corrosive and may cause irritation upon contact with skin or mucous membranes. Overall, isoxazole-5-carbonyl chloride is a valuable reagent in synthetic organic chemistry.
Formula:C4H2ClNO2
InChI:InChI=1/C4H2ClNO2/c5-4(7)3-1-2-6-8-3/h1-2H
SMILES:c1cnoc1C(=O)Cl
Synonyms:- 5-Isoxazolecarboxylic acid chloride
- Isoxazole-5-carbonychlordie
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Isoxazole-5-carbonyl chloride, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C4H2ClNO2Purity:97%Color and Shape:Clear colorless to very pale yellow, LiquidMolecular weight:131.52Isoxazole-5-carbonyl chloride
CAS:Formula:C4H2ClNO2Purity:97%Color and Shape:LiquidMolecular weight:131.5172Isoxazole-5-carbonyl chloride
CAS:Isoxazole-5-carbonyl chlorideFormula:C4H2ClNO2Purity:techColor and Shape: opaque. very dark red/brown liquidMolecular weight:131.52g/molIsoxazole-5-carbonyl chloride
CAS:Isoxazole-5-carbonyl chlorideFormula:C4H2ClNO2Purity:97%Color and Shape: clear. light yellow liquidMolecular weight:131.52g/molIsoxazole-5-carbonyl chloride
CAS:Formula:C4H2ClNO2Purity:95.0%Color and Shape:LiquidMolecular weight:131.52Isoxazole-5-carbonyl chloride
CAS:<p>Isoxazole-5-carbonyl chloride is a fine chemical that is used as a building block in the synthesis of various compounds. It is also used as an intermediate in the production of research chemicals, such as pharmaceuticals and pesticides. Reaction with other chemicals produces complex compounds that are useful for a variety of purposes, such as high-quality reagents or speciality chemicals. Isoxazole-5-carbonyl chloride can be used to make a variety of useful substances, such as pharmaceuticals and pesticides.</p>Formula:C12H12N2Molecular weight:184.24 g/mol




