CAS 62351-47-7
:magnesium bromide 3,5-difluorobenzenide
Description:
Magnesium bromide 3,5-difluorobenzenide, with the CAS number 62351-47-7, is a chemical compound that features magnesium as a central metal ion coordinated with bromide ions and a 3,5-difluorobenzenide ligand. This compound typically exhibits characteristics associated with organometallic complexes, including ionic and covalent bonding interactions. The presence of the 3,5-difluorobenzenide moiety introduces unique electronic properties due to the fluorine substituents, which can influence the compound's reactivity and stability. Magnesium bromide itself is known for its hygroscopic nature and is often used in various chemical reactions, including Grignard reactions. The overall structure of this compound suggests potential applications in organic synthesis and materials science, particularly in the development of new catalysts or intermediates. Additionally, the fluorinated aromatic ring may enhance the compound's solubility and reactivity in specific solvents, making it a subject of interest in both academic and industrial research settings.
Formula:C6H3BrF2Mg
InChI:InChI=1/C6H3F2.BrH.Mg/c7-5-2-1-3-6(8)4-5;;/h2-4H;1H;/q-1;;+2/p-1
SMILES:C1=CC(=C[C-](C=1)F)F.Br.[Mg]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3,5-Difluorophenylmagnesium bromide, 0.50M in 2-MeTHF
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3BrF2MgMolecular weight:217.293,5-Difluorophenylmagnesium bromide
CAS:3,5-Difluorophenylmagnesium bromidePurity:≥95%Color and Shape:Brown SolutionMolecular weight:217.29g/mol

